C16H24N4S2 — CID 162532402
3-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole (PubChem CID 162532402) has the molecular formula C16H24N4S2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 3-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 162532402 |
| Molecular Formula | C16H24N4S2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole |
| SMILES | CC1(C)CN2C(CSC3=N[C@H]4CCCC[C@@H]4CN3)=CSC2=N1 |
| InChI | InChI=1S/C16H24N4S2/c1-16(2)10-20-12(9-22-15(20)19-16)8-21-14-17-7-11-5-3-4-6-13(11)18-14/h9,11,13H,3-8,10H2,1-2H3,(H,17,18)/t11-,13+/m1/s1 |
| InChIKey | LMEVDGSQTCYGND-YPMHNXCESA-N |
| XLogP | 3.28 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |