C10H7FN2O3 — CID 162532898
5-fluoro-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one (PubChem CID 162532898) has the molecular formula C10H7FN2O3 and a molecular weight of 222.17 g/mol. Its IUPAC name is 5-fluoro-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one.
| Compound Name | 5-fluoro-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one |
|---|---|
| PubChem CID | 162532898 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-fluoro-7,8-dihydro-3H-[1,4]dioxino[2,3-g]quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc3c(c(F)c12)OCCO3 |
| InChI | InChI=1S/C10H7FN2O3/c11-8-7-5(12-4-13-10(7)14)3-6-9(8)16-2-1-15-6/h3-4H,1-2H2,(H,12,13,14) |
| InChIKey | COYSRBINMCJBAE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |