C16H22N2O — CID 162533512
2-(aminomethyl)-6-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one (PubChem CID 162533512) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(aminomethyl)-6-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one.
| Compound Name | 2-(aminomethyl)-6-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 162533512 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-(aminomethyl)-6-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
| SMILES | NCC1CC(=O)C2CC(c3ccccc3)CCC2N1 |
| InChI | InChI=1S/C16H22N2O/c17-10-13-9-16(19)14-8-12(6-7-15(14)18-13)11-4-2-1-3-5-11/h1-5,12-15,18H,6-10,17H2 |
| InChIKey | USQCAEDGMNKXER-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |