C26H36N4O4 — CID 162533645
(3R)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 162533645) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is (3R)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3R)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 162533645 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (3R)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CN(C)c1ccc(CCC(=O)N2CC3CCCC3[C@@H]2C(=O)N[C@H](C=O)C[C@@H]2CCNC2=O)cc1 |
| InChI | InChI=1S/C26H36N4O4/c1-29(2)21-9-6-17(7-10-21)8-11-23(32)30-15-19-4-3-5-22(19)24(30)26(34)28-20(16-31)14-18-12-13-27-25(18)33/h6-7,9-10,16,18-20,22,24H,3-5,8,11-15H2,1-2H3,(H,27,33)(H,28,34)/t18-,19?,20-,22?,24+/m0/s1 |
| InChIKey | NXGBAEZSUURIHI-QBJDBKRTSA-N |
| XLogP | 1.52 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|