C22H29N3O4 — CID 162533705
4-methyl-N-[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide (PubChem CID 162533705) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-methyl-N-[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide.
| Compound Name | 4-methyl-N-[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide |
|---|---|
| PubChem CID | 162533705 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 4-methyl-N-[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide |
| SMILES | CC(C)CC(NC(=O)/C=C/c1ccccc1)C(=O)NC(C=O)CC1CCNC1=O |
| InChI | InChI=1S/C22H29N3O4/c1-15(2)12-19(25-20(27)9-8-16-6-4-3-5-7-16)22(29)24-18(14-26)13-17-10-11-23-21(17)28/h3-9,14-15,17-19H,10-13H2,1-2H3,(H,23,28)(H,24,29)(H,25,27)/b9-8+ |
| InChIKey | WLXCENLBBWQJML-CMDGGOBGSA-N |
| XLogP | 1.44 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|