C21H18F5N5O4 — CID 162533922
2-[4-[4-(difluoromethoxy)-2-methylanilino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide (PubChem CID 162533922) has the molecular formula C21H18F5N5O4 and a molecular weight of 499.40 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)-2-methylanilino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[4-(difluoromethoxy)-2-methylanilino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 162533922 |
| Molecular Formula | C21H18F5N5O4 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)-2-methylanilino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(=O)nc(Nc2ccc(OC(F)F)cc2C)n(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C21H18F5N5O4/c1-10-5-12(35-18(25)26)3-4-15(10)28-19-29-20(33)31(9-16(32)27-2)21(34)30(19)8-11-6-13(22)17(24)14(23)7-11/h3-7,18H,8-9H2,1-2H3,(H,27,32)(H,28,29,33) |
| InChIKey | JHDIUUFGPILEJO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|