C21H17ClF3N7O3 — CID 162533923
2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide (PubChem CID 162533923) has the molecular formula C21H17ClF3N7O3 and a molecular weight of 507.86 g/mol. Its IUPAC name is 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 162533923 |
| Molecular Formula | C21H17ClF3N7O3 |
| Molecular Weight | 507.86 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[4-[(6-chloro-2-methylindazol-5-yl)amino]-2,6-dioxo-3-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(=O)nc(Nc2cc3cn(C)nc3cc2Cl)n(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C21H17ClF3N7O3/c1-26-17(33)9-32-20(34)28-19(27-16-5-11-8-30(2)29-15(11)6-12(16)22)31(21(32)35)7-10-3-13(23)18(25)14(24)4-10/h3-6,8H,7,9H2,1-2H3,(H,26,33)(H,27,28,34) |
| InChIKey | XAGVUVLRKSMPAA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.86 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|