C13H16BrNO6 — CID 162533973
3-bromo-N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide (PubChem CID 162533973) has the molecular formula C13H16BrNO6 and a molecular weight of 362.18 g/mol. Its IUPAC name is 3-bromo-N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide.
| Compound Name | 3-bromo-N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 162533973 |
| Molecular Formula | C13H16BrNO6 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-bromo-N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrNO6/c14-7-3-1-2-6(4-7)12(19)15-9-11(18)10(17)8(5-16)21-13(9)20/h1-4,8-11,13,16-18,20H,5H2,(H,15,19)/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | RVVGAIYGOTZFAS-TWEVDUBQSA-N |
| XLogP | -1.02 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |