About Silyl phenyl triflate
Silyl phenyl triflate (PubChem CID 162534336) has the molecular formula C7H4F3O3SSi
and a molecular weight of 253.25 g/mol.
Molecular Properties
| Compound Name | Silyl phenyl triflate |
| PubChem CID | 162534336 |
| Molecular Formula | C7H4F3O3SSi |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | — |
| SMILES | O=S(=O)(Oc1ccccc1[Si])C(F)(F)F |
| InChI | InChI=1S/C7H4F3O3SSi/c8-7(9,10)14(11,12)13-5-3-1-2-4-6(5)15/h1-4H |
| InChIKey | VEHGDLRJZQHUQF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze Silyl phenyl triflate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silyl phenyl triflate?
The IUPAC name of Silyl phenyl triflate (CID 162534336) is not available.
What is the SMILES notation for Silyl phenyl triflate?
The canonical SMILES for Silyl phenyl triflate is O=S(=O)(Oc1ccccc1[Si])C(F)(F)F.
What is the InChIKey of Silyl phenyl triflate?
The InChIKey is VEHGDLRJZQHUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3O3SSi/c8-7(9,10)14(11,12)13-5-3-1-2-4-6(5)15/h1-4H.
What are the key properties of Silyl phenyl triflate?
Silyl phenyl triflate has a molecular weight of 253.25 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Silyl phenyl triflate is sourced from PubChem (CID 162534336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).