About 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid
2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid (PubChem CID 162534448) has the molecular formula C29H19F3I2O3S
and a molecular weight of 758.34 g/mol. Its IUPAC name is 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid |
| PubChem CID | 162534448 |
| Molecular Formula | C29H19F3I2O3S |
| Molecular Weight | 758.34 g/mol |
| Exact Mass | 757.91 |
| IUPAC Name | 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid |
| SMILES | Ic1ccccc1-c1c(I)c(-c2ccccc2)c2ccccc2c1-c1ccccc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C28H18I2.CHF3O3S/c29-24-18-10-9-17-23(24)27-25(19-11-3-1-4-12-19)21-15-7-8-16-22(21)26(28(27)30)20-13-5-2-6-14-20;2-1(3,4)8(5,6)7/h1-18H;(H,5,6,7) |
| InChIKey | IISUJVBODPLKFA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 758.34 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid?
The IUPAC name of 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid (CID 162534448) is 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid.
What is the SMILES notation for 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid?
The canonical SMILES for 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid is Ic1ccccc1-c1c(I)c(-c2ccccc2)c2ccccc2c1-c1ccccc1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid?
The InChIKey is IISUJVBODPLKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18I2.CHF3O3S/c29-24-18-10-9-17-23(24)27-25(19-11-3-1-4-12-19)21-15-7-8-16-22(21)26(28(27)30)20-13-5-2-6-14-20;2-1(3,4)8(5,6)7/h1-18H;(H,5,6,7).
What are the key properties of 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid?
2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid has a molecular weight of 758.34 g/mol, XLogP of 9.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-3-(2-iodophenyl)-1,4-diphenylnaphthalene;trifluoromethanesulfonic acid is sourced from PubChem (CID 162534448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).