About [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate
[3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate (PubChem CID 162534473) has the molecular formula C10H3F9INO3S
and a molecular weight of 515.09 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate |
| PubChem CID | 162534473 |
| Molecular Formula | C10H3F9INO3S |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 514.87 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate |
| SMILES | N#C[I+]c1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H3F6IN.CHF3O3S/c10-8(11,12)5-1-6(9(13,14)15)3-7(2-5)16-4-17;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DCRRICHSPSSSJM-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate (CID 162534473) is [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate is N#C[I+]c1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate?
The InChIKey is DCRRICHSPSSSJM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H3F6IN.CHF3O3S/c10-8(11,12)5-1-6(9(13,14)15)3-7(2-5)16-4-17;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7)/q+1;/p-1.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate?
[3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate has a molecular weight of 515.09 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]-cyanoiodanium;trifluoromethanesulfonate is sourced from PubChem (CID 162534473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).