About 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine
2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine (PubChem CID 162534662) has the molecular formula C14H12F3NOS2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine |
| PubChem CID | 162534662 |
| Molecular Formula | C14H12F3NOS2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine |
| SMILES | FC(F)(F)SC1CC(c2ccsc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C14H12F3NOS2/c15-14(16,17)21-13-8-12(10-6-7-20-9-10)18(19-13)11-4-2-1-3-5-11/h1-7,9,12-13H,8H2 |
| InChIKey | MFPQXQWAVZIDFV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine?
The IUPAC name of 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine (CID 162534662) is 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine.
What is the SMILES notation for 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine?
The canonical SMILES for 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine is FC(F)(F)SC1CC(c2ccsc2)N(c2ccccc2)O1.
What is the InChIKey of 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine?
The InChIKey is MFPQXQWAVZIDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NOS2/c15-14(16,17)21-13-8-12(10-6-7-20-9-10)18(19-13)11-4-2-1-3-5-11/h1-7,9,12-13H,8H2.
What are the key properties of 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine?
2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine has a molecular weight of 331.38 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-thiophen-3-yl-5-(trifluoromethylsulfanyl)-1,2-oxazolidine is sourced from PubChem (CID 162534662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).