About N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide
N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide (PubChem CID 162534763) has the molecular formula C8H11F3N2O2S
and a molecular weight of 256.25 g/mol. Its IUPAC name is N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide |
| PubChem CID | 162534763 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide |
| SMILES | C=CCCCN(CC#N)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2S/c1-2-3-4-6-13(7-5-12)16(14,15)8(9,10)11/h2H,1,3-4,6-7H2 |
| InChIKey | MTDAJOJWNIGGKW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide?
The IUPAC name of N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide (CID 162534763) is N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide.
What is the SMILES notation for N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide?
The canonical SMILES for N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide is C=CCCCN(CC#N)S(=O)(=O)C(F)(F)F.
What is the InChIKey of N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide?
The InChIKey is MTDAJOJWNIGGKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O2S/c1-2-3-4-6-13(7-5-12)16(14,15)8(9,10)11/h2H,1,3-4,6-7H2.
What are the key properties of N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide?
N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide has a molecular weight of 256.25 g/mol, XLogP of 1.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-1,1,1-trifluoro-N-pent-4-enylmethanesulfonamide is sourced from PubChem (CID 162534763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).