About 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine
6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine (PubChem CID 162534915) has the molecular formula C18H10F3N3
and a molecular weight of 325.29 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine.
Molecular Properties
| Compound Name | 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine |
| PubChem CID | 162534915 |
| Molecular Formula | C18H10F3N3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine |
| SMILES | FC(F)(F)c1ccc(-c2nc3ncccc3c3cccnc23)cc1 |
| InChI | InChI=1S/C18H10F3N3/c19-18(20,21)12-7-5-11(6-8-12)15-16-13(3-1-9-22-16)14-4-2-10-23-17(14)24-15/h1-10H |
| InChIKey | NEICOHAHJJOJRK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine?
The IUPAC name of 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine (CID 162534915) is 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine.
What is the SMILES notation for 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine?
The canonical SMILES for 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine is FC(F)(F)c1ccc(-c2nc3ncccc3c3cccnc23)cc1.
What is the InChIKey of 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine?
The InChIKey is NEICOHAHJJOJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3N3/c19-18(20,21)12-7-5-11(6-8-12)15-16-13(3-1-9-22-16)14-4-2-10-23-17(14)24-15/h1-10H.
What are the key properties of 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine?
6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine has a molecular weight of 325.29 g/mol, XLogP of 4.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(trifluoromethyl)phenyl]pyrido[2,3-c][1,8]naphthyridine is sourced from PubChem (CID 162534915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).