C12H7F15N2O2 — CID 162535079
1-methylimidazole;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid (PubChem CID 162535079) has the molecular formula C12H7F15N2O2 and a molecular weight of 496.17 g/mol. Its IUPAC name is 1-methylimidazole;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid.
| Compound Name | 1-methylimidazole;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid |
|---|---|
| PubChem CID | 162535079 |
| Molecular Formula | C12H7F15N2O2 |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 1-methylimidazole;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid |
| SMILES | Cn1ccnc1.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O2.C4H6N2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;1-6-3-2-5-4-6/h(H,24,25);2-4H,1H3 |
| InChIKey | WPALMBJHSLOAAS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|