About 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone
2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone (PubChem CID 162535764) has the molecular formula C8H5F3O2
and a molecular weight of 190.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone |
| PubChem CID | 162535764 |
| Molecular Formula | C8H5F3O2 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone |
| SMILES | O=C(C(F)(F)F)C12C=CC=CC1O2 |
| InChI | InChI=1S/C8H5F3O2/c9-8(10,11)6(12)7-4-2-1-3-5(7)13-7/h1-5H |
| InChIKey | KPSQQRHVTFAOHY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone?
The IUPAC name of 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone (CID 162535764) is 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone?
The canonical SMILES for 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone is O=C(C(F)(F)F)C12C=CC=CC1O2.
What is the InChIKey of 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone?
The InChIKey is KPSQQRHVTFAOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O2/c9-8(10,11)6(12)7-4-2-1-3-5(7)13-7/h1-5H.
What are the key properties of 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone?
2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone has a molecular weight of 190.12 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 162535764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).