C9H2F10N2 — CID 162535838
3,4,5,5,6,6,7,7,8,8-decafluoroquinolin-2-amine (PubChem CID 162535838) has the molecular formula C9H2F10N2 and a molecular weight of 328.11 g/mol. Its IUPAC name is 3,4,5,5,6,6,7,7,8,8-decafluoroquinolin-2-amine.
| Compound Name | 3,4,5,5,6,6,7,7,8,8-decafluoroquinolin-2-amine |
|---|---|
| PubChem CID | 162535838 |
| Molecular Formula | C9H2F10N2 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 3,4,5,5,6,6,7,7,8,8-decafluoroquinolin-2-amine |
| SMILES | Nc1nc2c(c(F)c1F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C9H2F10N2/c10-2-1-4(21-5(20)3(2)11)7(14,15)9(18,19)8(16,17)6(1,12)13/h(H2,20,21) |
| InChIKey | FFJDKJVHVXTFLH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|