C25H21F3N2O3 — CID 162536040
1,1,1-trifluoro-2-(4-methoxyphenyl)-3-(3-oxido-4,5-diphenylimidazol-3-ium-1-yl)propan-2-ol (PubChem CID 162536040) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(4-methoxyphenyl)-3-(3-oxido-4,5-diphenylimidazol-3-ium-1-yl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(4-methoxyphenyl)-3-(3-oxido-4,5-diphenylimidazol-3-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 162536040 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1,1,1-trifluoro-2-(4-methoxyphenyl)-3-(3-oxido-4,5-diphenylimidazol-3-ium-1-yl)propan-2-ol |
| SMILES | COc1ccc(C(O)(Cn2c[n+]([O-])c(-c3ccccc3)c2-c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F3N2O3/c1-33-21-14-12-20(13-15-21)24(31,25(26,27)28)16-29-17-30(32)23(19-10-6-3-7-11-19)22(29)18-8-4-2-5-9-18/h2-15,17,31H,16H2,1H3 |
| InChIKey | LWSGLZOWMGDUBV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|