C11H17F6NO — CID 162536215
N,N-diethyl-5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-amine (PubChem CID 162536215) has the molecular formula C11H17F6NO and a molecular weight of 293.25 g/mol. Its IUPAC name is N,N-diethyl-5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-amine.
| Compound Name | N,N-diethyl-5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-amine |
|---|---|
| PubChem CID | 162536215 |
| Molecular Formula | C11H17F6NO |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N,N-diethyl-5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-amine |
| SMILES | CCN(CC)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H17F6NO/c1-3-18(4-2)8-6-5-7(19-8)10(13,14)9(12)11(15,16)17/h7-9H,3-6H2,1-2H3 |
| InChIKey | OMJQTHCNJDIPQC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |