C12F20 — CID 162536243
5-(1,1,2,2,2-pentafluoroethyl)-1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene (PubChem CID 162536243) has the molecular formula C12F20 and a molecular weight of 524.09 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 162536243 |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1,2,3,4,5-pentakis(trifluoromethyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(C(F)(F)F)=C1C(F)(F)F |
| InChI | InChI=1S/C12F20/c13-6(14,15)1-2(7(16,17)18)4(9(22,23)24)5(11(27,28)29,3(1)8(19,20)21)10(25,26)12(30,31)32 |
| InChIKey | ATCWQOYOBSZPDR-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|