C12H8ClF4N3 — CID 162536393
4-anilino-5-chloro-1,5,6,6-tetrafluoro-4H-pyridine-3-carbonitrile (PubChem CID 162536393) has the molecular formula C12H8ClF4N3 and a molecular weight of 305.66 g/mol. Its IUPAC name is 4-anilino-5-chloro-1,5,6,6-tetrafluoro-4H-pyridine-3-carbonitrile.
| Compound Name | 4-anilino-5-chloro-1,5,6,6-tetrafluoro-4H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162536393 |
| Molecular Formula | C12H8ClF4N3 |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-anilino-5-chloro-1,5,6,6-tetrafluoro-4H-pyridine-3-carbonitrile |
| SMILES | N#CC1=CN(F)C(F)(F)C(F)(Cl)C1Nc1ccccc1 |
| InChI | InChI=1S/C12H8ClF4N3/c13-11(14)10(19-9-4-2-1-3-5-9)8(6-18)7-20(17)12(11,15)16/h1-5,7,10,19H |
| InChIKey | WHQAZRVNFQSXHL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|