C10H21F6NSi2 — CID 162536500
2,2,3,4,4,4-hexafluoro-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 162536500) has the molecular formula C10H21F6NSi2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluoro-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | 2,2,3,4,4,4-hexafluoro-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 162536500 |
| Molecular Formula | C10H21F6NSi2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2,2,3,4,4,4-hexafluoro-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | C[Si](C)(C)N(CC(F)(F)C(F)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C10H21F6NSi2/c1-18(2,3)17(19(4,5)6)7-9(12,13)8(11)10(14,15)16/h8H,7H2,1-6H3 |
| InChIKey | IXEZCMVWEJXDSK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|