C10H4F6 — CID 162536554
2,2,3,6,6,7-hexafluoronaphthalene (PubChem CID 162536554) has the molecular formula C10H4F6 and a molecular weight of 238.13 g/mol. Its IUPAC name is 2,2,3,6,6,7-hexafluoronaphthalene.
| Compound Name | 2,2,3,6,6,7-hexafluoronaphthalene |
|---|---|
| PubChem CID | 162536554 |
| Molecular Formula | C10H4F6 |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2,2,3,6,6,7-hexafluoronaphthalene |
| SMILES | FC1=CC2=CC(F)(F)C(F)=CC2=CC1(F)F |
| InChI | InChI=1S/C10H4F6/c11-7-1-5-3-10(15,16)8(12)2-6(5)4-9(7,13)14/h1-4H |
| InChIKey | BKXPFSMQECRODT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |