C21H39F3N5O6P3 — CID 162536612
[4,7-bis[[hydroxy(methyl)phosphoryl]methyl]-10-[[5-(trifluoromethyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl-methylphosphinic acid (PubChem CID 162536612) has the molecular formula C21H39F3N5O6P3 and a molecular weight of 607.49 g/mol. Its IUPAC name is [4,7-bis[[hydroxy(methyl)phosphoryl]methyl]-10-[[5-(trifluoromethyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl-methylphosphinic acid.
| Compound Name | [4,7-bis[[hydroxy(methyl)phosphoryl]methyl]-10-[[5-(trifluoromethyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl-methylphosphinic acid |
|---|---|
| PubChem CID | 162536612 |
| Molecular Formula | C21H39F3N5O6P3 |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | [4,7-bis[[hydroxy(methyl)phosphoryl]methyl]-10-[[5-(trifluoromethyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl-methylphosphinic acid |
| SMILES | CP(=O)(O)CN1CCN(Cc2ccc(C(F)(F)F)cn2)CCN(CP(C)(=O)O)CCN(CP(C)(=O)O)CC1 |
| InChI | InChI=1S/C21H39F3N5O6P3/c1-36(30,31)16-27-8-6-26(15-20-5-4-19(14-25-20)21(22,23)24)7-9-28(17-37(2,32)33)11-13-29(12-10-27)18-38(3,34)35/h4-5,14H,6-13,15-18H2,1-3H3,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | HZWAXDKQWUCNLW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|