About S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate
S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate (PubChem CID 162536880) has the molecular formula C22H41F3O5S
and a molecular weight of 474.63 g/mol. Its IUPAC name is S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate.
Molecular Properties
| Compound Name | S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate |
| PubChem CID | 162536880 |
| Molecular Formula | C22H41F3O5S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCCCCCOCCOCCOCCOCCCC(F)(F)F |
| InChI | InChI=1S/C22H41F3O5S/c1-21(26)31-20-9-7-5-3-2-4-6-8-12-27-14-16-29-18-19-30-17-15-28-13-10-11-22(23,24)25/h2-20H2,1H3 |
| InChIKey | FUROZCXAEZNBRM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The IUPAC name of S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate (CID 162536880) is S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate.
What is the SMILES notation for S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The canonical SMILES for S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate is CC(=O)SCCCCCCCCCCOCCOCCOCCOCCCC(F)(F)F.
What is the InChIKey of S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The InChIKey is FUROZCXAEZNBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41F3O5S/c1-21(26)31-20-9-7-5-3-2-4-6-8-12-27-14-16-29-18-19-30-17-15-28-13-10-11-22(23,24)25/h2-20H2,1H3.
What are the key properties of S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate has a molecular weight of 474.63 g/mol, XLogP of 5.80, 23 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[10-[2-[2-[2-(4,4,4-trifluorobutoxy)ethoxy]ethoxy]ethoxy]decyl] ethanethioate is sourced from PubChem (CID 162536880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).