About S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate
S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate (PubChem CID 162536883) has the molecular formula C23H43F3O6S
and a molecular weight of 504.65 g/mol. Its IUPAC name is S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate.
Molecular Properties
| Compound Name | S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate |
| PubChem CID | 162536883 |
| Molecular Formula | C23H43F3O6S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCCCCCOCCOCCOCCOCCOCCC(F)(F)F |
| InChI | InChI=1S/C23H43F3O6S/c1-22(27)33-21-9-7-5-3-2-4-6-8-11-28-13-15-30-17-19-32-20-18-31-16-14-29-12-10-23(24,25)26/h2-21H2,1H3 |
| InChIKey | KDYLJEMDFNPLST-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The IUPAC name of S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate (CID 162536883) is S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate.
What is the SMILES notation for S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The canonical SMILES for S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate is CC(=O)SCCCCCCCCCCOCCOCCOCCOCCOCCC(F)(F)F.
What is the InChIKey of S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
The InChIKey is KDYLJEMDFNPLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H43F3O6S/c1-22(27)33-21-9-7-5-3-2-4-6-8-11-28-13-15-30-17-19-32-20-18-31-16-14-29-12-10-23(24,25)26/h2-21H2,1H3.
What are the key properties of S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate?
S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate has a molecular weight of 504.65 g/mol, XLogP of 5.42, 25 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-[10-[2-[2-[2-[2-(3,3,3-trifluoropropoxy)ethoxy]ethoxy]ethoxy]ethoxy]decyl] ethanethioate is sourced from PubChem (CID 162536883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).