C18H25F3O8 — CID 162537158
ethyl (E)-3-[(4R,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2,2-trifluoroacetyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 162537158) has the molecular formula C18H25F3O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2,2-trifluoroacetyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2,2-trifluoroacetyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162537158 |
| Molecular Formula | C18H25F3O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2,2-trifluoroacetyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(C)(C)O[C@H]1[C@@H](OC(=O)C(F)(F)F)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H25F3O8/c1-6-24-12(22)8-7-10-14(29-17(4,5)27-10)13(26-15(23)18(19,20)21)11-9-25-16(2,3)28-11/h7-8,10-11,13-14H,6,9H2,1-5H3/b8-7+/t10-,11-,13+,14-/m1/s1 |
| InChIKey | ZXNZHIBXACSXCE-ZMMBXPSUSA-N |
| XLogP | 2.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|