About zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride
zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride (PubChem CID 162537183) has the molecular formula C7H10ClF2NO2Zn
and a molecular weight of 279.00 g/mol. Its IUPAC name is zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride.
Molecular Properties
| Compound Name | zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride |
| PubChem CID | 162537183 |
| Molecular Formula | C7H10ClF2NO2Zn |
| Molecular Weight | 279.00 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride |
| SMILES | CCN(CC)C(=O)O[C-]=C(F)F.[Cl-].[Zn+2] |
| InChI | InChI=1S/C7H10F2NO2.ClH.Zn/c1-3-10(4-2)7(11)12-5-6(8)9;;/h3-4H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | NFEAXLTWQLKESU-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.00 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride?
The IUPAC name of zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride (CID 162537183) is zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride.
What is the SMILES notation for zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride?
The canonical SMILES for zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride is CCN(CC)C(=O)O[C-]=C(F)F.[Cl-].[Zn+2].
What is the InChIKey of zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride?
The InChIKey is NFEAXLTWQLKESU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10F2NO2.ClH.Zn/c1-3-10(4-2)7(11)12-5-6(8)9;;/h3-4H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride?
zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride has a molecular weight of 279.00 g/mol, XLogP of -0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2,2-difluoroethenyl N,N-diethylcarbamate;chloride is sourced from PubChem (CID 162537183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).