About 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole
3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole (PubChem CID 162537743) has the molecular formula C8H6F3N2OP
and a molecular weight of 234.12 g/mol. Its IUPAC name is 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole.
Molecular Properties
| Compound Name | 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole |
| PubChem CID | 162537743 |
| Molecular Formula | C8H6F3N2OP |
| Molecular Weight | 234.12 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole |
| SMILES | FC(F)(F)C1=NN(c2ccccc2)PO1 |
| InChI | InChI=1S/C8H6F3N2OP/c9-8(10,11)7-12-13(15-14-7)6-4-2-1-3-5-6/h1-5,15H |
| InChIKey | SCSGZPBXULVTMK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole?
The IUPAC name of 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole (CID 162537743) is 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole.
What is the SMILES notation for 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole?
The canonical SMILES for 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole is FC(F)(F)C1=NN(c2ccccc2)PO1.
What is the InChIKey of 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole?
The InChIKey is SCSGZPBXULVTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N2OP/c9-8(10,11)7-12-13(15-14-7)6-4-2-1-3-5-6/h1-5,15H.
What are the key properties of 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole?
3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole has a molecular weight of 234.12 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-(trifluoromethyl)-2H-1,3,4,2-oxadiazaphosphole is sourced from PubChem (CID 162537743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).