C40H67F15O5Si3 — CID 162538163
(4R,5R,7R)-4,5,7-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]deca-2,9-dienoic acid (PubChem CID 162538163) has the molecular formula C40H67F15O5Si3 and a molecular weight of 997.20 g/mol. Its IUPAC name is (4R,5R,7R)-4,5,7-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]deca-2,9-dienoic acid.
| Compound Name | (4R,5R,7R)-4,5,7-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]deca-2,9-dienoic acid |
|---|---|
| PubChem CID | 162538163 |
| Molecular Formula | C40H67F15O5Si3 |
| Molecular Weight | 997.20 g/mol |
| Exact Mass | 996.41 |
| IUPAC Name | (4R,5R,7R)-4,5,7-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]deca-2,9-dienoic acid |
| SMILES | C=CC[C@H](C[C@@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)[C@@H](C=CC(=O)O)O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H67F15O5Si3/c1-14-15-31(58-61(25(2)3,26(4)5)21-18-35(41,42)38(47,48)49)24-33(60-63(29(10)11,30(12)13)23-20-37(45,46)40(53,54)55)32(16-17-34(56)57)59-62(27(6)7,28(8)9)22-19-36(43,44)39(50,51)52/h14,16-17,25-33H,1,15,18-24H2,2-13H3,(H,56,57)/t31-,32-,33-/m1/s1 |
| InChIKey | VCBNGBNDVKDUSU-WRVRXEDSSA-N |
| XLogP | 15.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.20 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|