C48H83F15O5Si3 — CID 162538164
(5R,6R,8R,14R)-5,6,8-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]-14-pentyl-1-oxacyclotetradec-3-en-2-one (PubChem CID 162538164) has the molecular formula C48H83F15O5Si3 and a molecular weight of 1109.41 g/mol. Its IUPAC name is (5R,6R,8R,14R)-5,6,8-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]-14-pentyl-1-oxacyclotetradec-3-en-2-one.
| Compound Name | (5R,6R,8R,14R)-5,6,8-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]-14-pentyl-1-oxacyclotetradec-3-en-2-one |
|---|---|
| PubChem CID | 162538164 |
| Molecular Formula | C48H83F15O5Si3 |
| Molecular Weight | 1109.41 g/mol |
| Exact Mass | 1108.53 |
| IUPAC Name | (5R,6R,8R,14R)-5,6,8-tris[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]-14-pentyl-1-oxacyclotetradec-3-en-2-one |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)C[C@@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)[C@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)C=CC(=O)O1 |
| InChI | InChI=1S/C48H83F15O5Si3/c1-14-15-17-20-38-21-18-16-19-22-39(66-69(32(2)3,33(4)5)28-25-43(49,50)46(55,56)57)31-41(68-71(36(10)11,37(12)13)30-27-45(53,54)48(61,62)63)40(23-24-42(64)65-38)67-70(34(6)7,35(8)9)29-26-44(51,52)47(58,59)60/h23-24,32-41H,14-22,25-31H2,1-13H3/t38-,39-,40-,41-/m1/s1 |
| InChIKey | NFTPGSZTVDTBJL-GAKQXGIYSA-N |
| XLogP | 18.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1109.41 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|