C29H48F10O4Si2 — CID 162538168
methyl (2E,4R,5S)-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]octa-2,7-dienoate (PubChem CID 162538168) has the molecular formula C29H48F10O4Si2 and a molecular weight of 706.85 g/mol. Its IUPAC name is methyl (2E,4R,5S)-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]octa-2,7-dienoate.
| Compound Name | methyl (2E,4R,5S)-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]octa-2,7-dienoate |
|---|---|
| PubChem CID | 162538168 |
| Molecular Formula | C29H48F10O4Si2 |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | methyl (2E,4R,5S)-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]octa-2,7-dienoate |
| SMILES | C=CC[C@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)[C@@H](/C=C/C(=O)OC)O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H48F10O4Si2/c1-11-12-23(42-44(19(2)3,20(4)5)17-15-26(30,31)28(34,35)36)24(13-14-25(40)41-10)43-45(21(6)7,22(8)9)18-16-27(32,33)29(37,38)39/h11,13-14,19-24H,1,12,15-18H2,2-10H3/b14-13+/t23-,24+/m0/s1 |
| InChIKey | ADYDIDCGTMOCEW-FGTQWKHKSA-N |
| XLogP | 10.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|