C22H33F11O2Si — CID 162538236
(7E)-6-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-5,7-dimethylnona-1,7-dien-4-ol (PubChem CID 162538236) has the molecular formula C22H33F11O2Si and a molecular weight of 566.57 g/mol. Its IUPAC name is (7E)-6-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-5,7-dimethylnona-1,7-dien-4-ol.
| Compound Name | (7E)-6-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-5,7-dimethylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 162538236 |
| Molecular Formula | C22H33F11O2Si |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (7E)-6-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-5,7-dimethylnona-1,7-dien-4-ol |
| SMILES | C=CCC(O)C(C)C(O[Si](C(C)C)(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)/C(C)=C/C |
| InChI | InChI=1S/C22H33F11O2Si/c1-9-11-16(34)15(8)17(14(7)10-2)35-36(12(3)4,13(5)6)22(32,33)20(27,28)18(23,24)19(25,26)21(29,30)31/h9-10,12-13,15-17,34H,1,11H2,2-8H3/b14-10+ |
| InChIKey | QYDIAQONBBMZNI-GXDHUFHOSA-N |
| XLogP | 8.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|