C27H45F11O3Si2 — CID 162538239
(E)-3-[tert-butyl(dimethyl)silyl]oxy-5-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-4,6-dimethyloct-6-enal (PubChem CID 162538239) has the molecular formula C27H45F11O3Si2 and a molecular weight of 682.80 g/mol. Its IUPAC name is (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-4,6-dimethyloct-6-enal.
| Compound Name | (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-4,6-dimethyloct-6-enal |
|---|---|
| PubChem CID | 162538239 |
| Molecular Formula | C27H45F11O3Si2 |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.27 |
| IUPAC Name | (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-[di(propan-2-yl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silyl]oxy-4,6-dimethyloct-6-enal |
| SMILES | C/C=C(\C)C(O[Si](C(C)C)(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)C(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H45F11O3Si2/c1-13-18(6)21(19(7)20(14-15-39)40-42(11,12)22(8,9)10)41-43(16(2)3,17(4)5)27(37,38)25(32,33)23(28,29)24(30,31)26(34,35)36/h13,15-17,19-21H,14H2,1-12H3/b18-13+ |
| InChIKey | KUZHRWQCXMVIHH-QGOAFFKASA-N |
| XLogP | 10.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|