C21H12F6O3 — CID 162538499
2,5-bis[4-(trifluoromethoxy)phenyl]benzaldehyde (PubChem CID 162538499) has the molecular formula C21H12F6O3 and a molecular weight of 426.31 g/mol. Its IUPAC name is 2,5-bis[4-(trifluoromethoxy)phenyl]benzaldehyde.
| Compound Name | 2,5-bis[4-(trifluoromethoxy)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 162538499 |
| Molecular Formula | C21H12F6O3 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2,5-bis[4-(trifluoromethoxy)phenyl]benzaldehyde |
| SMILES | O=Cc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H12F6O3/c22-20(23,24)29-17-6-1-13(2-7-17)15-5-10-19(16(11-15)12-28)14-3-8-18(9-4-14)30-21(25,26)27/h1-12H |
| InChIKey | UOXQYYOPKRYXFC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|