C18H10F26 — CID 162538604
1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-8-prop-2-enylpentadecane (PubChem CID 162538604) has the molecular formula C18H10F26 and a molecular weight of 720.23 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-8-prop-2-enylpentadecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-8-prop-2-enylpentadecane |
|---|---|
| PubChem CID | 162538604 |
| Molecular Formula | C18H10F26 |
| Molecular Weight | 720.23 g/mol |
| Exact Mass | 720.04 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-8-prop-2-enylpentadecane |
| SMILES | C=CCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H10F26/c1-2-3-6(4-7(19,20)9(23,24)11(27,28)13(31,32)15(35,36)17(39,40)41)5-8(21,22)10(25,26)12(29,30)14(33,34)16(37,38)18(42,43)44/h2,6H,1,3-5H2 |
| InChIKey | PEGMHWQMDXHDOX-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.23 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|