C8H6F12N2 — CID 162538783
N,N,N',N'-tetrakis(trifluoromethyl)but-2-ene-1,4-diamine (PubChem CID 162538783) has the molecular formula C8H6F12N2 and a molecular weight of 358.13 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(trifluoromethyl)but-2-ene-1,4-diamine.
| Compound Name | N,N,N',N'-tetrakis(trifluoromethyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 162538783 |
| Molecular Formula | C8H6F12N2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N,N,N',N'-tetrakis(trifluoromethyl)but-2-ene-1,4-diamine |
| SMILES | FC(F)(F)N(CC=CCN(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12N2/c9-5(10,11)21(6(12,13)14)3-1-2-4-22(7(15,16)17)8(18,19)20/h1-2H,3-4H2 |
| InChIKey | KPTXEAOEFKPXDB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|