C27H35F3N2O2 — CID 162538814
1-[3-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]cyclohexane-1-carboxylic acid (PubChem CID 162538814) has the molecular formula C27H35F3N2O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-[3-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162538814 |
| Molecular Formula | C27H35F3N2O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 1-[3-[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CCCC3(C(=O)O)CCCCC3)CC21 |
| InChI | InChI=1S/C27H35F3N2O2/c1-17-21-16-32(12-5-11-26(25(33)34)9-3-2-4-10-26)13-8-18(21)14-23-24(17)20-15-19(27(28,29)30)6-7-22(20)31-23/h6-7,15,17-18,21,31H,2-5,8-14,16H2,1H3,(H,33,34) |
| InChIKey | OBGPNQWQROKGFI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|