C25H31F6NOSi — CID 162539463
[(S)-[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-tert-butyl-dimethylsilane (PubChem CID 162539463) has the molecular formula C25H31F6NOSi and a molecular weight of 503.60 g/mol. Its IUPAC name is [(S)-[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(S)-[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162539463 |
| Molecular Formula | C25H31F6NOSi |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [(S)-[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@](c1ccccc1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C25H31F6NOSi/c1-22(2,3)34(4,5)33-23(21-12-9-13-32-21,17-10-7-6-8-11-17)18-14-19(24(26,27)28)16-20(15-18)25(29,30)31/h6-8,10-11,14-16,21,32H,9,12-13H2,1-5H3/t21-,23-/m0/s1 |
| InChIKey | LUVROAWUGCNAFP-GMAHTHKFSA-N |
| XLogP | 7.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|