C17H13F3O2 — CID 162539487
1-(methoxymethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene (PubChem CID 162539487) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-(methoxymethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene.
| Compound Name | 1-(methoxymethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 162539487 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(methoxymethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzene |
| SMILES | COCOc1ccccc1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3O2/c1-21-12-22-16-5-3-2-4-14(16)9-6-13-7-10-15(11-8-13)17(18,19)20/h2-5,7-8,10-11H,12H2,1H3 |
| InChIKey | GQFAJRBNDJEPTJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|