C13H19F3O5 — CID 162539521
5-[(3aR,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1,1-trifluoropentan-2-one (PubChem CID 162539521) has the molecular formula C13H19F3O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 5-[(3aR,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1,1-trifluoropentan-2-one.
| Compound Name | 5-[(3aR,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 162539521 |
| Molecular Formula | C13H19F3O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-[(3aR,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1,1-trifluoropentan-2-one |
| SMILES | COC1C(CCCC(=O)C(F)(F)F)O[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H19F3O5/c1-12(2)20-10-9(18-3)7(19-11(10)21-12)5-4-6-8(17)13(14,15)16/h7,9-11H,4-6H2,1-3H3/t7?,9?,10-,11-/m1/s1 |
| InChIKey | SPPXZDJZRUKNNR-LTCAWXSRSA-N |
| XLogP | 2.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |