C12H9Cl3F3NO — CID 162539570
6,8-dichloro-4-(2-chloro-3,3,3-trifluoropropyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 162539570) has the molecular formula C12H9Cl3F3NO and a molecular weight of 346.56 g/mol. Its IUPAC name is 6,8-dichloro-4-(2-chloro-3,3,3-trifluoropropyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6,8-dichloro-4-(2-chloro-3,3,3-trifluoropropyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 162539570 |
| Molecular Formula | C12H9Cl3F3NO |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 6,8-dichloro-4-(2-chloro-3,3,3-trifluoropropyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(CC(Cl)C(F)(F)F)c2cc(Cl)cc(Cl)c2N1 |
| InChI | InChI=1S/C12H9Cl3F3NO/c13-6-3-7-5(1-9(15)12(16,17)18)2-10(20)19-11(7)8(14)4-6/h3-5,9H,1-2H2,(H,19,20) |
| InChIKey | UJKUSWPWRXTOEU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|