About 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole
3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole (PubChem CID 162539575) has the molecular formula C12H13F2NO2S
and a molecular weight of 273.30 g/mol. Its IUPAC name is 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole |
| PubChem CID | 162539575 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole |
| SMILES | CS(=O)(=O)N1CC(CC=C(F)F)c2ccccc21 |
| InChI | InChI=1S/C12H13F2NO2S/c1-18(16,17)15-8-9(6-7-12(13)14)10-4-2-3-5-11(10)15/h2-5,7,9H,6,8H2,1H3 |
| InChIKey | RWZWWKQFZXUARG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole?
The IUPAC name of 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole (CID 162539575) is 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole.
What is the SMILES notation for 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole?
The canonical SMILES for 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole is CS(=O)(=O)N1CC(CC=C(F)F)c2ccccc21.
What is the InChIKey of 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole?
The InChIKey is RWZWWKQFZXUARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2S/c1-18(16,17)15-8-9(6-7-12(13)14)10-4-2-3-5-11(10)15/h2-5,7,9H,6,8H2,1H3.
What are the key properties of 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole?
3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole has a molecular weight of 273.30 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoroprop-2-enyl)-1-methylsulfonyl-2,3-dihydroindole is sourced from PubChem (CID 162539575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).