C22H21F3N2O8S — CID 162539812
dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-(3-nitrophenyl)but-3-en-2-yl]propanedioate (PubChem CID 162539812) has the molecular formula C22H21F3N2O8S and a molecular weight of 530.48 g/mol. Its IUPAC name is dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-(3-nitrophenyl)but-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-(3-nitrophenyl)but-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 162539812 |
| Molecular Formula | C22H21F3N2O8S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-(3-nitrophenyl)but-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=C(/NS(=O)(=O)c1ccc(C)cc1)c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O8S/c1-13-7-9-16(10-8-13)36(32,33)26-18(14-5-4-6-15(11-14)27(30)31)12-17(22(23,24)25)19(20(28)34-2)21(29)35-3/h4-12,17,19,26H,1-3H3/b18-12+/t17-/m0/s1 |
| InChIKey | IJJXJPHXDITXSZ-BOFQVRIASA-N |
| XLogP | 3.36 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|