C29H20F6OS3 — CID 162540260
S-[3-[5-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophen-2-yl]phenyl] ethanethioate (PubChem CID 162540260) has the molecular formula C29H20F6OS3 and a molecular weight of 594.67 g/mol. Its IUPAC name is S-[3-[5-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophen-2-yl]phenyl] ethanethioate.
| Compound Name | S-[3-[5-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophen-2-yl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 162540260 |
| Molecular Formula | C29H20F6OS3 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | S-[3-[5-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-4-methylthiophen-2-yl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1cccc(-c2cc(C)c(C3=C(c4cc(-c5ccccc5)sc4C)C(F)(F)C(F)(F)C3(F)F)s2)c1 |
| InChI | InChI=1S/C29H20F6OS3/c1-15-12-22(19-10-7-11-20(13-19)38-17(3)36)39-26(15)25-24(27(30,31)29(34,35)28(25,32)33)21-14-23(37-16(21)2)18-8-5-4-6-9-18/h4-14H,1-3H3 |
| InChIKey | QFUCRTRJJSOPQX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|