C19H15F3N2O3 — CID 162540354
8-methoxy-5-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]-1H-quinoline-2-carboxamide (PubChem CID 162540354) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 8-methoxy-5-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]-1H-quinoline-2-carboxamide.
| Compound Name | 8-methoxy-5-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 162540354 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 8-methoxy-5-methyl-4-oxo-N-[2-(trifluoromethyl)phenyl]-1H-quinoline-2-carboxamide |
| SMILES | COc1ccc(C)c2c(=O)cc(C(=O)Nc3ccccc3C(F)(F)F)[nH]c12 |
| InChI | InChI=1S/C19H15F3N2O3/c1-10-7-8-15(27-2)17-16(10)14(25)9-13(23-17)18(26)24-12-6-4-3-5-11(12)19(20,21)22/h3-9H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | XZDXWXPPCXLZQI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |