About 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene
1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene (PubChem CID 162540588) has the molecular formula C7H6F2S
and a molecular weight of 160.19 g/mol. Its IUPAC name is 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene.
Molecular Properties
| Compound Name | 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene |
| PubChem CID | 162540588 |
| Molecular Formula | C7H6F2S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene |
| SMILES | FC(F)SC1=C=CC=CC1 |
| InChI | InChI=1S/C7H6F2S/c8-7(9)10-6-4-2-1-3-5-6/h1-3,7H,4H2 |
| InChIKey | BVNBDDNOSCCMBR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene?
The IUPAC name of 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene (CID 162540588) is 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene.
What is the SMILES notation for 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene?
The canonical SMILES for 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene is FC(F)SC1=C=CC=CC1.
What is the InChIKey of 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene?
The InChIKey is BVNBDDNOSCCMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2S/c8-7(9)10-6-4-2-1-3-5-6/h1-3,7H,4H2.
What are the key properties of 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene?
1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene has a molecular weight of 160.19 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethylsulfanyl)cyclohexa-1,2,4-triene is sourced from PubChem (CID 162540588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).