C8H4F5OS+ — CID 162540630
oxo-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]sulfanium (PubChem CID 162540630) has the molecular formula C8H4F5OS+ and a molecular weight of 243.18 g/mol. Its IUPAC name is oxo-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]sulfanium.
| Compound Name | oxo-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 162540630 |
| Molecular Formula | C8H4F5OS+ |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | oxo-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]sulfanium |
| SMILES | O=[S+]c1ccccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F5OS/c9-7(10,8(11,12)13)5-3-1-2-4-6(5)15-14/h1-4H/q+1 |
| InChIKey | WSJMCXASHIDFEJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|