About cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane
cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane (PubChem CID 162540808) has the molecular formula C18H31F3O2Si
and a molecular weight of 364.52 g/mol. Its IUPAC name is cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane.
Molecular Properties
| Compound Name | cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane |
| PubChem CID | 162540808 |
| Molecular Formula | C18H31F3O2Si |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane |
| SMILES | C=CCC(CC(CCC)C(F)(F)F)O[Si](C)(C)C.O=C1C=CCC1 |
| InChI | InChI=1S/C13H25F3OSi.C5H6O/c1-6-8-11(13(14,15)16)10-12(9-7-2)17-18(3,4)5;6-5-3-1-2-4-5/h7,11-12H,2,6,8-10H2,1,3-5H3;1,3H,2,4H2 |
| InChIKey | ZXSMSOXYKNVINJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane?
The IUPAC name of cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane (CID 162540808) is cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane.
What is the SMILES notation for cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane?
The canonical SMILES for cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane is C=CCC(CC(CCC)C(F)(F)F)O[Si](C)(C)C.O=C1C=CCC1.
What is the InChIKey of cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane?
The InChIKey is ZXSMSOXYKNVINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3OSi.C5H6O/c1-6-8-11(13(14,15)16)10-12(9-7-2)17-18(3,4)5;6-5-3-1-2-4-5/h7,11-12H,2,6,8-10H2,1,3-5H3;1,3H,2,4H2.
What are the key properties of cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane?
cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane has a molecular weight of 364.52 g/mol, XLogP of 6.06, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-2-en-1-one;trimethyl-[6-(trifluoromethyl)non-1-en-4-yloxy]silane is sourced from PubChem (CID 162540808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).