C37H20BF18NO3 — CID 162540974
1H-pyrrole;tris(2,2,3,4,6,7-hexafluoro-5-methyl-1H-naphthalen-1-yl) borate (PubChem CID 162540974) has the molecular formula C37H20BF18NO3 and a molecular weight of 879.35 g/mol. Its IUPAC name is 1H-pyrrole;tris(2,2,3,4,6,7-hexafluoro-5-methyl-1H-naphthalen-1-yl) borate.
| Compound Name | 1H-pyrrole;tris(2,2,3,4,6,7-hexafluoro-5-methyl-1H-naphthalen-1-yl) borate |
|---|---|
| PubChem CID | 162540974 |
| Molecular Formula | C37H20BF18NO3 |
| Molecular Weight | 879.35 g/mol |
| Exact Mass | 879.12 |
| IUPAC Name | 1H-pyrrole;tris(2,2,3,4,6,7-hexafluoro-5-methyl-1H-naphthalen-1-yl) borate |
| SMILES | Cc1c(F)c(F)cc2c1C(F)=C(F)C(F)(F)C2OB(OC1c2cc(F)c(F)c(C)c2C(F)=C(F)C1(F)F)OC1c2cc(F)c(F)c(C)c2C(F)=C(F)C1(F)F.c1cc[nH]c1 |
| InChI | InChI=1S/C33H15BF18O3.C4H5N/c1-7-16-10(4-13(35)19(7)38)28(31(47,48)25(44)22(16)41)53-34(54-29-11-5-14(36)20(39)8(2)17(11)23(42)26(45)32(29,49)50)55-30-12-6-15(37)21(40)9(3)18(12)24(43)27(46)33(30,51)52;1-2-4-5-3-1/h4-6,28-30H,1-3H3;1-5H |
| InChIKey | YJKFKYWCCUADCM-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.35 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|